HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Acetyl-4-nitropyrrole
2-Acetyl-4-nitropyrrole · 2-Acetyl-4-nitro-1H-pyrrole · 1-(4-Nitro-1H-pyrrol-2-yl)ethanone · Ethanone, 1-(4-nitro-1H-pyrrol-2-yl)- · 1-(4-Nitro-1H-pyrrol-2-yl)ethan-1-one, 2-Ethanoyl-4-nitro-1H-pyrrole
Identifikatoren & physikalische Daten
| CAS No. | 32116-24-8 |
|---|---|
| Summenformel | C6H6N2O3 |
| Durchschnittliche Molmasse | 154,12 g/mol |
| Monoisotopische Masse | 154,03784206 g/mol |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c[nH]1 |
| InChIKey | DBXRYIUQTXMTEV-UHFFFAOYSA-N |
| PubChem CID | 36065 |
| DTXSID | DTXSID20185904 |
Chemische & physikalische Eigenschaften
| XLogP | 0,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 78,7 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 187 |
| Schmelzpunkt | 197 °C |
| Siedepunkt | 277.46°C (rough estimate) |
| Dichte | 1.4564 (rough estimate) |
| Brechungsindex | 1.5100 (estimate) |
| pKa (Säurekonstante) | 11.82±0.50(Predicted) |
Sicherheit & Vorschriften
| Zollcode | 2933998090 |
|---|
Anwendungen & Verwendung
Verwenden
2-Acetyl-4-nitropyrrole is used in the synthesis of pyrroles and indoles as potential antiviral agents.