Identifikatoren & physikalische Daten
| CAS No. | 93323-47-8 |
|---|
| Summenformel | C17H14N2O |
|---|
| Durchschnittliche Molmasse | 262,3 g/mol |
|---|
| SMILES | Cn1c(-c2ccccc2)c(-c2ccccc2)cnc1=O |
|---|
| InChIKey | BBNFFQUTCXFQIC-UHFFFAOYSA-N |
|---|
| PubChem CID | 3609352 |
|---|
| EC No. | 668-077-9 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|
| Polarare Oberfläche (TPSA) | 32,7 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 426 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P305+P351+P338, P330, P337+P317, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
