HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 3620004Erstellt: 4. November 2026
{1-[3-(5-Dimethylaminomethyl-tetrazol-1-yl)-phenyl]-1H-tetrazol-5-ylmethyl}-dimethyl-amine
https://huagongshe.com/de/chemical/3620004
Identifikatoren & physikalische Daten
| CAS No. | 133638-24-1 |
|---|
| Summenformel | C14H20N10 |
|---|
| Durchschnittliche Molmasse | 328,38 g/mol |
|---|
| Monoisotopische Masse | 328,18724068 g/mol |
|---|
| SMILES | CN(C)Cc1nnnn1-c1cccc(-n2nnnc2CN(C)C)c1 |
|---|
| InChIKey | QIZHMVVUOHXACW-UHFFFAOYSA-N |
|---|
| PubChem CID | 3620004 |
|---|
| ChEMBL | CHEMBL1905205 |
|---|
| DTXSID | DTXSID701324842 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 0,3 |
|---|
| Polarare Oberfläche (TPSA) | 93,7 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 8 |
|---|
| Frei drehbare Bindungen | 6 |
|---|
| Schwere Atome | 24 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 358 |
|---|
| Löslichkeit | 27.6 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von {1-[3-(5-Dimethylaminomethyl-tetrazol-1-yl)-phenyl]-1H-tetrazol-5-ylmethyl}-dimethyl-amine](/img/chemical/3620004.png)