HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-(1,2-dimethylheptyl)-7,8,9,10-tetrahydro-6,6,9-trimethyl-6H-dibenzo(b,d)pyran-1-ol
Dimethylheptylpyran · QBEFIFWEOSUTKV-UHFFFAOYSA-N · 3-(1,2-dimethylheptyl)-7,8,9,10-tetrahydro-6,6,9-trimethyl-6H-dibenzo(b,d)pyran-1-ol · 6H-Dibenzo[b,d]pyran-1-ol, 3-(1,2-dimethylheptyl)-7,8,9,10-tetrahydro-6,6,9-trimethyl-
Identifikatoren & physikalische Daten
| CAS No. | 32904-22-6 |
|---|---|
| Summenformel | C25H38O2 |
| Durchschnittliche Molmasse | 370,6 g/mol |
| Monoisotopische Masse | 370,28718045 g/mol |
| SMILES | CCCCCC(C)C(C)c1cc(O)c2c(c1)OC(C)(C)C1=C2CC(C)CC1 |
| InChIKey | QBEFIFWEOSUTKV-UHFFFAOYSA-N |
| PubChem CID | 36276 |
| ChEMBL | CHEMBL3244434 |
| DTXSID | DTXSID60954555 |
Chemische & physikalische Eigenschaften
| XLogP | 7,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 29,5 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 27 |
| Formalladung | 0 |
| Komplexität | 534 |
| Siedepunkt | 170-173 °C(Press: 0.04 Torr) |
| Dichte | 1.02±0.1 g/cm3(Predicted) |
| Lagerbedingungen | -20°C |
| pKa (Säurekonstante) | 10.01±0.60(Predicted) |
| Aggregatzustand | buffered aqueous solution |
| Biologische Quelle | rabbit |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | nwg |
|---|---|
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
Dimethylheptylpyran belongs to the cannabinoid class of molecule. Capable of binding to the cannabinoid receptor in cerebral cortex membranes effecting antinociception, hypothermia and catalepsy