HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-Methylbis(2,4-xylyliminomethyl)-amin
bipin · baam · imidamide · amitraze · 1,5-di(2,4-dimethylphenyl)-3-methyl-1,3,5-triazapenta-1,4-diene · ZAMIR · RACET · ISOKA
Identifikatoren & physikalische Daten
| CAS No. | 33089-61-1 |
|---|---|
| Summenformel | C19H23N3 |
| Durchschnittliche Molmasse | 293,4 g/mol |
| Monoisotopische Masse | 293,18919774 g/mol |
| SMILES | Cc1ccc(N=CN(C)C=Nc2ccc(C)cc2C)c(C)c1 |
| InChIKey | QXAITBQSYVNQDR-UHFFFAOYSA-N |
| PubChem CID | 36324 |
| ChEMBL | CHEMBL1365675 |
| ChEBI | CHEBI:2665 |
| DTXSID | DTXSID5023871 |
| Lokaler Name | N-Methylbis(2,4-xylyliminomethyl)-amin |
Chemische & physikalische Eigenschaften
| XLogP | 5,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 28 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 354 |
| Pestizide | Pesticides -> InsecticidesVeterinary substances, Acaricides, InsecticidesEnvironmental transformation -> Pesticides (parent, predecessor) |
| LogP (Verteilungskoeffizient) | 5.5 |
| Animal Drugs | Pharmaceuticals -> UK Veterinary Medicines Directorate List |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Schmelzpunkt | 86-87°C |
| Siedepunkt | 425.25°C (rough estimate) |
| Dichte | 1.1280 |
| Dampfdruck | 3.4×10-4 Pa (25 °C) |
| Brechungsindex | 1.5892 (estimate) |
| Lagerbedingungen | Sealed in dry,Store in freezer, under -20°C |
| Löslichkeit | DMF: 30 mg/mlDMF:PBS (pH 7.2) (1:2): 0.33 mg/mlDMSO: 20 mg/mlEthanol: 2 mg/ml0.08 mg l-1 |
| pKa (Säurekonstante) | 4.2 (weak base) |
| Aggregatzustand | Powder/Solid |
| Farbe | White |
| Merck | 14,486 |
| Henry-Konstante | 1.0×100 mol/(m3Pa) at 25℃, MacBean (2012) |
| Hauptanwendungen | agricultureenvironmental |
| InChI | 1S/C19H23N3/c1-14-6-8-18(16(3)10-14)20-12-22(5)13-21-19-9-7-15(2)11-17(19)4/h6-13H,1-5H3/b20-12+,21-13+ |
| InChIKey | QXAITBQSYVNQDR-ZIOPAAQOSA-N |
| SMILES | CN(\C=N\c1ccc(C)cc1C)\C=N\c2ccc(C)cc2C |
| CAS Datenbank | 33089-61-1(CAS DataBase Reference) |
| NIST chemische Informationen | Amitraz(33089-61-1) |
| EPA chemische Informationen | Amitraz (33089-61-1) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | UN 3077 |
| Zollcode | 29252900 |
| RTECS-Nr. | ZF0480000 |
| R-Sätze (R) | 22-43-48/22-50/53 |
| Toxizität | LD50 in male rats, female mice, rabbits, guinea pigs, bobwhite quail (mg/kg): 800, >1600, >100, >400, 788 orallyLD50 in rabbits, male rats (mg/kg): >200, >1600 dermallyLC50 (48 hr) in rainbow trout, Japanese carp: 3.3, 1.2 ppm (Labonne) |
| Gefahrensymbole | XnN,N,Xn |
| Sicherheitshinweise (S) | 22-24-36/37-60-61 |
| Gefahrenklasse | 9Acute Tox. 4 OralAquatic Acute 1Aquatic Chronic 1Skin Sens. 1STOT RE 2 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 33089-61-1(Hazardous Substances Data) |
Anwendungen & Verwendung
Verwenden
Amitraz is an antiparasitic used to control red spider mites, leaf miners and scale insects. This compound is active by inhibiting the targets monoaminooxidase enzyme.