HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 3690953Erstellt: 3. November 2026
2-methyl-N-(5-methyl-2-pyridinyl)-5-oxo-4-(3-phenoxyphenyl)-1,4,5,6,7,8-hexahydro-3-quinolinecarboxamide
2-methyl-N-(5-methyl-2-pyridinyl)-5-oxo-4-(3-phenoxyphenyl)-1,4,5,6,7,8-hexahydro-3-quinolinecarboxamide
https://huagongshe.com/de/chemical/3690953
Identifikatoren & physikalische Daten
| CAS No. | 362487-28-3 |
|---|
| Summenformel | C29H27N3O3 |
|---|
| Durchschnittliche Molmasse | 465,5 g/mol |
|---|
| Monoisotopische Masse | 465,20524173 g/mol |
|---|
| SMILES | CC1=C(C(=O)Nc2ccc(C)cn2)C(c2cccc(Oc3ccccc3)c2)C2=C(CCCC2=O)N1 |
|---|
| InChIKey | RXYHNQSTRPUBKZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 3690953 |
|---|
| EC No. | 133-066-5 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4,6 |
|---|
| Polarare Oberfläche (TPSA) | 80,3 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 35 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 872 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
