Identifikatoren & physikalische Daten
| CAS No. | 303755-60-4 |
|---|
| Summenformel | C20H15NO2S |
|---|
| Durchschnittliche Molmasse | 333,4 g/mol |
|---|
| Monoisotopische Masse | 333,08234989 g/mol |
|---|
| SMILES | O=S(=O)(Nc1cccc2ccccc12)c1ccc2ccccc2c1 |
|---|
| InChIKey | GVMQOMHWFLBJRK-UHFFFAOYSA-N |
|---|
| PubChem CID | 3692610 |
|---|
| ChEMBL | CHEMBL3392510 |
|---|
| EC No. | 140-987-6 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4,9 |
|---|
| Polarare Oberfläche (TPSA) | 54,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 24 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 526 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | H413 (100%): May cause long lasting harmful effects to aquatic life [Hazardous to the aquatic environment, long-term hazard]P273, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Aquatic Chronic 4 (100%) |
|---|
