Identifikatoren & physikalische Daten
| CAS No. | 34831-03-3 |
|---|
| Summenformel | C6H7NNiO6 |
|---|
| Durchschnittliche Molmasse | 247,82 g/mol |
|---|
| Monoisotopische Masse | 246,962679 g/mol |
|---|
| SMILES | O=C([O-])CN(CC(=O)[O-])CC(=O)O.[Ni+2] |
|---|
| InChIKey | ADHAUWMNDHMUMH-UHFFFAOYSA-L |
|---|
| PubChem CID | 36939 |
|---|
| DTXSID | DTXSID7067873 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 121 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 7 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 14 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 198 |
|---|
Sicherheit & Vorschriften
| Regulatorische Informationen | Nickelate(1-), N,N-bis(carboxy-.kappa.O)methylglycinato(3-)-.kappa.N,.kappa.O-, hydrogen, (T-4)-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
|---|
