HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(4-chlorophenyl){4-[4-(dimethylamino)phenyl]-1-methyltetrahydro-1H-pyrrol-3-yl}methanone
4-[4-(4-chlorobenzoyl)-1-methylpyrrolidin-3-yl]-N,N-dimethylaniline · Methanone, (4-chlorophenyl)[4-[4-(dimethylamino)phenyl]-1-methyl-3-pyrrolidinyl]- · (4-Chlorophenyl)(4-[4-(dimethylamino)phenyl]-1-methyltetrahydro-1H-pyrrol-3-yl)methanone
![Molekülstruktur von (4-chlorophenyl){4-[4-(dimethylamino)phenyl]-1-methyltetrahydro-1H-pyrrol-3-yl}methanone](/img/chemical/3695977.png)
Identifikatoren & physikalische Daten
| CAS No. | 478050-07-6 |
|---|---|
| Summenformel | C20H23ClN2O |
| Durchschnittliche Molmasse | 342,9 g/mol |
| Monoisotopische Masse | 342,1498911 g/mol |
| SMILES | CN1CC(C(=O)c2ccc(Cl)cc2)C(c2ccc(N(C)C)cc2)C1 |
| InChIKey | RBXMSAUXWFTAFL-UHFFFAOYSA-N |
| PubChem CID | 3695977 |
| ChEMBL | CHEMBL1547221 |
| DTXSID | DTXSID201328520 |
Chemische & physikalische Eigenschaften
| XLogP | 3,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 23,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 24 |
| Formalladung | 0 |
| Komplexität | 425 |
| Löslichkeit | 47.1 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 489.4±45.0 °C(Predicted) |
| Dichte | 1.178±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 8.75±0.60(Predicted) |