Identifikatoren & physikalische Daten
| CAS No. | 58457-42-4 |
|---|
| Summenformel | C13H12N2 |
|---|
| Durchschnittliche Molmasse | 196,25 g/mol |
|---|
| Monoisotopische Masse | 196,10004839 g/mol |
|---|
| SMILES | Cc1[nH]c2c(ccc3cccnc32)c1C |
|---|
| InChIKey | APTDWHWHMIIOLV-UHFFFAOYSA-N |
|---|
| PubChem CID | 3696582 |
|---|
| ChEMBL | CHEMBL1362472 |
|---|
| DTXSID | DTXSID001321566 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|
| Polarare Oberfläche (TPSA) | 28,7 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 241 |
|---|
| Löslichkeit | 19.4 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von 2,3-Dimethyl-1H-pyrrolo[3,2-h]quinoline](/img/chemical/3696582.png)