HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 3696769Erstellt: 3. November 2026
2-(2,6-dimethylmorpholino)-N'-(diphenylmethylene)acetohydrazide
2-(2,6-Dimethylmorpholino)-N'-(diphenylmethylene)acetohydrazide · 4-Morpholineacetic acid, 2,6-dimethyl-, 2-(diphenylmethylene)hydrazide
https://huagongshe.com/de/chemical/3696769
Identifikatoren & physikalische Daten
| CAS No. | 478247-24-4 |
|---|
| Summenformel | C21H25N3O2 |
|---|
| Durchschnittliche Molmasse | 351,4 g/mol |
|---|
| Monoisotopische Masse | 351,19467705 g/mol |
|---|
| SMILES | CC1CN(CC(=O)NN=C(c2ccccc2)c2ccccc2)CC(C)O1 |
|---|
| InChIKey | CGMYGPAGIWQBBA-UHFFFAOYSA-N |
|---|
| PubChem CID | 3696769 |
|---|
| ChEMBL | CHEMBL1375368 |
|---|
| DTXSID | DTXSID201322877 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,6 |
|---|
| Polarare Oberfläche (TPSA) | 53,9 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 26 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 452 |
|---|
| Löslichkeit | 30.8 [ug/mL] (The mean of the results at pH 7.4) |
|---|
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
