HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Floctafenic acid
floctafenic acid · 2-[[8-(TrifluoroMethyl)-4-quinolinyl]aMino]benzoic Acid · Benzoic acid, 2-[[8-(trifluoromethyl)-4-quinolinyl]amino]-
Identifikatoren & physikalische Daten
| CAS No. | 36783-34-3 |
|---|---|
| Summenformel | C17H11F3N2O2 |
| Durchschnittliche Molmasse | 332,28 g/mol |
| Monoisotopische Masse | 332,07726225 g/mol |
| SMILES | O=C(O)c1ccccc1Nc1ccnc2c(C(F)(F)F)cccc12 |
| InChIKey | RGUIKQRAZCQMBM-UHFFFAOYSA-N |
| PubChem CID | 37541 |
| EC No. | 807-265-9 |
| DTXSID | DTXSID60190254 |
Chemische & physikalische Eigenschaften
| XLogP | 4,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 62,2 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 7 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 24 |
| Formalladung | 0 |
| Komplexität | 458 |
| Schmelzpunkt | 238-240°C |
| Siedepunkt | 461.1±45.0 °C(Predicted) |
| Dichte | 1.451±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Refrigerator |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 3.46±0.36(Predicted) |
| Farbe | Yellow |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Alarmwort | Warnung |
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
Floctafenic Acid is an impurity of Floctafenine (F401700).