HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 3758949Erstellt: 3. November 2026
1-(3-aminophenyl)-2-(3,5-dimethyl-1H-pyrazol-1-yl)-1-ethanone
1-(3-aminophenyl)-2-(3,5-dimethylpyrazol-1-yl)ethanone · Ethanone, 1-(3-aminophenyl)-2-(3,5-dimethyl-1H-pyrazol-1-yl)- · 1-(3-aminophenyl)-2-(3,5-dimethyl-1H-pyrazol-1-yl)-1-ethanone
https://huagongshe.com/de/chemical/3758949
Identifikatoren & physikalische Daten
| CAS No. | 956206-44-3 |
|---|
| Summenformel | C13H15N3O |
|---|
| Durchschnittliche Molmasse | 229,28 g/mol |
|---|
| Monoisotopische Masse | 229,12151211 g/mol |
|---|
| SMILES | Cc1cc(C)n(CC(=O)c2cccc(N)c2)n1 |
|---|
| InChIKey | DUEWUNYSGOOXBJ-UHFFFAOYSA-N |
|---|
| PubChem CID | 3758949 |
|---|
| ChEMBL | CHEMBL1903625 |
|---|
| DTXSID | DTXSID501321678 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|
| Polarare Oberfläche (TPSA) | 60,9 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 17 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 282 |
|---|
| Löslichkeit | 32.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
| Schmelzpunkt | 140-143° |
|---|
| Siedepunkt | 444.5±40.0 °C(Predicted) |
|---|
| Dichte | 1.18±0.1 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 3.25±0.10(Predicted) |
|---|
Sicherheit & Vorschriften
