HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Phenylspiro[furan-2(3H),1'(3'H)-isobenzofuran]-3,3'-dion
FLURAM · Fluaram · FLURAM(R) · RO 20-7234 · Fluorescamin · FLUORESCAMINE · FluorescamineA.R. · Fluorescamine, pure
![Molekülstruktur von 4-Phenylspiro[furan-2(3H),1'(3'H)-isobenzofuran]-3,3'-dion](/img/chemical/37927.png)
Identifikatoren & physikalische Daten
| CAS No. | 38183-12-9 |
|---|---|
| Summenformel | C17H10O4 |
| Durchschnittliche Molmasse | 278,26 g/mol |
| Monoisotopische Masse | 278,0579088 g/mol |
| SMILES | O=C1OC2(OC=C(c3ccccc3)C2=O)c2ccccc21 |
| InChIKey | ZFKJVJIDPQDDFY-UHFFFAOYSA-N |
| PubChem CID | 37927 |
| EC No. | 253-814-5 |
| DTXSID | DTXSID50872017 |
| Lokaler Name | 4-Phenylspiro[furan-2(3H),1'(3'H)-isobenzofuran]-3,3'-dion |
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 52,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 503 |
| Stoffklassen | Dyes -> Indicator Dyes |
| Physical Description | Off-white odorless powder[Alfa Aesar MSDS] |
| Schmelzpunkt | 153-157 °C (lit.) |
| Siedepunkt | 381.08°C (rough estimate) |
| Dichte | 1.2661 (rough estimate) |
| Brechungsindex | 1.5447 (estimate) |
| Flammpunkt | -17 °C |
| Lagerbedingungen | room temp |
| Löslichkeit | acetonitrile: solubleSoluble in acetone, ethanol, chloroform, dimethylsulfoxide and acetonitrile. Slightly soluble in water. |
| Aggregatzustand | powder |
| Farbe | off-white to yellow |
| Merck | 14,4158 |
| BRN | 921143 |
| Stabilität | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C17H10O4/c18-15-13(11-6-2-1-3-7-11)10-20-17(15)14-9-5-4-8-12(14)16(19)21-17/h1-10H |
| InChIKey | ZFKJVJIDPQDDFY-UHFFFAOYSA-N |
| SMILES | O=C1OC2(OC=C(C2=O)c3ccccc3)c4ccccc14 |
| CAS Datenbank | 38183-12-9(CAS DataBase Reference) |
| NIST chemische Informationen | Spiro[furan-2(3h),1'(3'h)-isobenzofuran]-3,3'-dione, 4-phenyl-(38183-12-9) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P261, P264+P265, P271, P280, P304+P340, P305+P351+P338, P319, P337+P317, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Regulatorische Informationen | Spiro[furan-2(3H),1'(3'H)-isobenzofuran]-3,3'-dione, 4-phenyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Gefahrenübersicht | May cause irritation[Alfa Aesar MSDS] |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1090 3/PG 2 |
| Zollcode | 29322090 |
| R-Sätze (R) | 11-36/38-66-67-36-36/37/38 |
| Gefahrensymbole | F,Xi |
| Sicherheitshinweise (S) | 22-24/25-36/37-33-29-26-16-9-37/39 |
| Lagerklasse | 13 - Non Combustible Solids |
Anwendungen & Verwendung
Verwenden
Fluorescamine is a non-fluorescent reagent that reacts readily under mild conditions with primary amines in amino acids and peptides to form stable, highly fluorescent compounds. Reaction takes place under mild conditions. Low background due to hydrolysis.