HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 3824366Erstellt: 26. Oktober 2026
4-Anilino-3-nitrobenzoic acid
Benzoic acid,3-nitro-4-(phenylaMino)-
https://huagongshe.com/de/chemical/3824366
Identifikatoren & physikalische Daten
| CAS No. | 16927-49-4 |
|---|
| Summenformel | C13H10N2O4 |
|---|
| Durchschnittliche Molmasse | 258,23 g/mol |
|---|
| Monoisotopische Masse | 258,0640568 g/mol |
|---|
| SMILES | O=C(O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 |
|---|
| InChIKey | UGUUCNPLYAGMNG-UHFFFAOYSA-N |
|---|
| PubChem CID | 3824366 |
|---|
| ChEMBL | CHEMBL237296 |
|---|
| EC No. | 991-532-0 |
|---|
| DTXSID | DTXSID40396914 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|
| Polarare Oberfläche (TPSA) | 95,2 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 336 |
|---|
| Schmelzpunkt | 262 °C |
|---|
| Siedepunkt | 445.7±40.0 °C(Predicted) |
|---|
| Dichte | 1.435±0.06 g/cm3(Predicted) |
|---|
| Lagerbedingungen | 2-8°C |
|---|
| pKa (Säurekonstante) | 4.15±0.10(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Gefahrenklasse | IRRITANT |
|---|
