HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Phenylethylacetoacetat
1-phenylethyl acetoacetate · GSBJXOIVIOYPOW-UHFFFAOYSA-N · Acetoacetic acid 1-phenethyl ester · 3-Oxobutyric acid 1-phenylethyl ester · Butanoic acid, 3-oxo-, 1-phenylethyl ester
Identifikatoren & physikalische Daten
| CAS No. | 40552-84-9 |
|---|---|
| Summenformel | C12H14O3 |
| Durchschnittliche Molmasse | 206,24 g/mol |
| Monoisotopische Masse | 206,0942943 g/mol |
| SMILES | CC(=O)CC(=O)OC(C)c1ccccc1 |
| InChIKey | GSBJXOIVIOYPOW-UHFFFAOYSA-N |
| PubChem CID | 38515 |
| EC No. | 254-973-3 |
| DTXSID | DTXSID30885807 |
| Lokaler Name | 1-Phenylethylacetoacetat |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 43,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 229 |
| Siedepunkt | 133-140 °C(Press: 3 Torr) |
| Dichte | 1.087±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 10.27±0.46(Predicted) |
| LogP (Verteilungskoeffizient) | 2.380 (est) |
| EPA chemische Informationen | 1-Phenylethyl acetoacetate (40552-84-9) |
Sicherheit & Vorschriften
| Regulatorische Informationen | Chemical: Butanoic acid, 3-oxo-, 1-phenylethyl ester |
|---|---|
| Weitere Sicherheitsinformationen | Evaluation - Chemicals not considered for in depth evaluation - Not commercially active in Australia |
| TSCA-Inventar-Status | TSCA listed |
Anwendungen & Verwendung
Verwenden
1-Phenylethyl 3-Oxobutanoate is an intermediate for the synthesis of cis-Crotoxyphos (C818825), which is an insecticide.