HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 3914739Erstellt: 2. November 2026
[2-(3-Morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate
https://huagongshe.com/de/chemical/3914739
Identifikatoren & physikalische Daten
| CAS No. | 391652-47-4 |
|---|
| Summenformel | C18H17Cl2N3O6S |
|---|
| Durchschnittliche Molmasse | 474,3 g/mol |
|---|
| Monoisotopische Masse | 473,0215118 g/mol |
|---|
| SMILES | O=C(COC(=O)c1cnc(Cl)c(Cl)c1)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
|---|
| InChIKey | CLYVJOBFXBISGI-UHFFFAOYSA-N |
|---|
| PubChem CID | 3914739 |
|---|
| ChEMBL | CHEMBL1902103 |
|---|
| DTXSID | DTXSID701332792 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|
| Polarare Oberfläche (TPSA) | 123 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 8 |
|---|
| Frei drehbare Bindungen | 7 |
|---|
| Schwere Atome | 30 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 713 |
|---|
| Löslichkeit | 38.9 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-(3-Morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate](/img/chemical/3914739.png)