Identifikatoren & physikalische Daten
| CAS No. | 386277-02-7 |
|---|
| Summenformel | C17H20BrNO4 |
|---|
| Durchschnittliche Molmasse | 382,2 g/mol |
|---|
| Monoisotopische Masse | 381,05757 g/mol |
|---|
| SMILES | O=C(COC(=O)c1ccc(Br)o1)NC12CC3CC(CC(C3)C1)C2 |
|---|
| InChIKey | LKIJSXYDXJGSJV-UHFFFAOYSA-N |
|---|
| PubChem CID | 3940596 |
|---|
| ChEMBL | CHEMBL1711068 |
|---|
| DTXSID | DTXSID901320284 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4,2 |
|---|
| Polarare Oberfläche (TPSA) | 68,5 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 23 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 468 |
|---|
| Löslichkeit | 34.3 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-(1-Adamantylamino)-2-oxoethyl] 5-bromofuran-2-carboxylate](/img/chemical/3940596.png)