HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N,N'-Bis(2,2'-dithiosalicyl)hydrazide
NSC 704783 · N,N'-BIS(2-MERCAPTOBENZOYL)HYDRAZIDE · N,N'-Bis(2,2'-dithiosalicyl)hydrazide · Tetrabenzo[c,i,m,s][1,2,11,12,6,7,16,17]tetrathiatetraazacycloeicosine-11,14,25,28-tetrone, 12,13,26,27-tetrahydro-
Identifikatoren & physikalische Daten
| CAS No. | 292615-40-8 |
|---|---|
| Summenformel | C28H20N4O4S4 |
| Durchschnittliche Molmasse | 604,8 g/mol |
| Monoisotopische Masse | 604,03673983 g/mol |
| SMILES | O=C1NNC(=O)c2ccccc2SSc2ccccc2C(=O)NNC(=O)c2ccccc2SSc2ccccc21 |
| InChIKey | ZFFCQXUXSGUXST-UHFFFAOYSA-N |
| PubChem CID | 397255 |
| ChEMBL | CHEMBL152850 |
| DTXSID | DTXSID30327934 |
Chemische & physikalische Eigenschaften
| XLogP | 5,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 218 |
| H-Brücken-Donoren | 4 |
| H-Brücken-Akzeptoren | 8 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 40 |
| Formalladung | 0 |
| Komplexität | 783 |
| Schmelzpunkt | 148°C dec. |
| Siedepunkt | 889.0±65.0 °C(Predicted) |
| Dichte | 1.368±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 9.45±0.20(Predicted) |
| Aggregatzustand | Powder |
| Farbe | White to Beige |
| Stabilität | Air Sensitive |
Anwendungen & Verwendung
Verwenden
A selective inhibitor of HIV-1 integrase. Has no other effect on other retroviral targets, including reverse transcriptase, protease, and virus attachement, and exhibits no detectable activity agains t human topoisomerases I and II at concentrations that effectively inhibit integrase.