HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
9,10-Didehydro-6-methylergolin-8β-methanol
Ergoitol · Lysergole · Pausinystalia yohimbe · LYSERGOL · Lysergol,97% · LYSERGOL 97% · Lysergol CAS · Ergot alcohol
Identifikatoren & physikalische Daten
| CAS No. | 602-85-7 |
|---|---|
| Summenformel | C16H18N2O |
| Durchschnittliche Molmasse | 254,33 g/mol |
| Monoisotopische Masse | 254,1419132 g/mol |
| SMILES | CN1CC(CO)C=C2c3cccc4[nH]cc(c34)CC21 |
| InChIKey | BIXJFIJYBLJTMK-UHFFFAOYSA-N |
| PubChem CID | 3982 |
| DTXSID | DTXSID40975627 |
| Lokaler Name | 9,10-Didehydro-6-methylergolin-8β-methanol |
Chemische & physikalische Eigenschaften
| XLogP | 2,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 39,3 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 394 |
| Schmelzpunkt | 248°C |
| Siedepunkt | 397.54°C (rough estimate) |
| Dichte | 1.0398 (rough estimate) |
| Brechungsindex | 1.6240 (estimate) |
| Lagerbedingungen | Store at -20°C |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly), Pyridine (Slightly) |
| pKa (Säurekonstante) | 14.61±0.10(Predicted) |
| Aggregatzustand | Solid |
| Farbe | Pale Brown to Light Brown |
| InChI | InChI=1/C16H18N2O/c1-18-8-10(9-19)5-13-12-3-2-4-14-16(12)11(7-17-14)6-15(13)18/h2-5,7,10,15,17,19H,6,8-9H2,1H3/t10-,15-/s3 |
| InChIKey | BIXJFIJYBLJTMK-HFQWXNFCNA-N |
| SMILES | CN1C[C@H](CO)C=C2C3=CC=CC4NC=C(C3=4)C[C@@]12[H] |&1:3,18,r| |
| LogP (Verteilungskoeffizient) | 1.760 (est) |
Sicherheit & Vorschriften
| UN-Transportnummer | 1544 |
|---|---|
| R-Sätze (R) | 26/27/28-36/37/38-25 |
| Gefahrensymbole | T+,T |
| Sicherheitshinweise (S) | 26-36/37/39-45-36/37 |
| Gefahrenklasse | 6.1(a) |
| Verpackungsgruppe | II |
Anwendungen & Verwendung
Verwenden
Lysergol is an ergot alkaloid which when used in combination with antibiotic nalidixic acid, can effectively inhibit Escherichia coli. It also maintains the potential to act on the 5-HT1/2 receptors and at α1-adrenergic receptors thus acting as a neuropsychiatric drug.