HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Phenyl-3-(1,2,3-thiadiazol-5-yl)harnstoff
TDZ · Thiadiazuron · Thidiazurone · Lift · DROPP · defolit · sn49537 · Avguron
Identifikatoren & physikalische Daten
| CAS No. | 51707-55-2 |
|---|---|
| Summenformel | C9H8N4OS |
| Durchschnittliche Molmasse | 220,25 g/mol |
| Monoisotopische Masse | 220,04188206 g/mol |
| SMILES | O=C(Nc1ccccc1)Nc1cnns1 |
| InChIKey | HFCYZXMHUIHAQI-UHFFFAOYSA-N |
| PubChem CID | 40087 |
| ChEMBL | CHEMBL505661 |
| ChEBI | CHEBI:81977 |
| EC No. | 257-356-7 |
| DTXSID | DTXSID0032651 |
| Lokaler Name | 1-Phenyl-3-(1,2,3-thiadiazol-5-yl)harnstoff |
Chemische & physikalische Eigenschaften
| XLogP | 1,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 95,2 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 220 |
| Schmelzpunkt | 213°C |
| Dichte | 1.3493 (rough estimate) |
| Brechungsindex | 1.6390 (estimate) |
| Lagerbedingungen | Sealed in dry,2-8°C |
| Löslichkeit | Soluble in DMSO |
| pKa (Säurekonstante) | 12.06±0.70(Predicted) |
| Aggregatzustand | Solid |
| Farbe | Light yellow to yellow |
| Merck | 13,9384 |
| BRN | 1078092 |
| Henry-Konstante | 3.0×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| Hauptanwendungen | agriculture |
| InChI | InChI=1S/C9H8N4OS/c14-9(12-8-6-10-13-15-8)11-7-4-2-1-3-5-7/h1-6H,(H2,11,12,14) |
| InChIKey | HFCYZXMHUIHAQI-UHFFFAOYSA-N |
| SMILES | N(C1=CC=CC=C1)C(NC1SN=NC=1)=O |
| CAS Datenbank | 51707-55-2(CAS DataBase Reference) |
| EPA chemische Informationen | Thidiazuron (51707-55-2) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | UN 3077 9 / PGIII |
| Zollcode | 2934999090 |
| RTECS-Nr. | YU1395000 |
| R-Sätze (R) | 36/37/38-51/53 |
| Toxizität | LC50 (96-hour) for bluegill sunsh, channel catsh and rainbow trout >1,000 mg/L (Hartley and Kidd, 1987)acute oral LD50 for rats >5,000 mg/kg (Hartley and Kidd, 1987), 5,350 mg/kg (RTECS, 1985). |
| Gefahrensymbole | Xi,N |
| Sicherheitshinweise (S) | 22-26-36-61 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 51707-55-2(Hazardous Substances Data) |
| Gefahrenklasse | Aquatic Acute 1Aquatic Chronic 1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
Thidiazuron is a non-purine containing urea derivative with cytokinin activity. Thidiazuron is used as a cotton defoliant and a plant growth regulator in tissue culture.