HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
L-4-Aminoisoxazolidin-3-on
(S)-4-Aminoisoxazolidin-3-one · Levcycloserine · 102.09 · cycloserinr · L-CYCLOSERIN · H-CYCLOSERINE · L-Cycloserine · Cyclo-L-serine
Identifikatoren & physikalische Daten
| CAS No. | 339-72-0 |
|---|---|
| Summenformel | C3H6N2O2 |
| Durchschnittliche Molmasse | 102,09 g/mol |
| Monoisotopische Masse | 102,04292744 g/mol |
| SMILES | NC1CONC1=O |
| InChIKey | DYDCUQKUCUHJBH-UHFFFAOYSA-N |
| PubChem CID | 401 |
| ChEMBL | CHEMBL8151 |
| ChEBI | CHEBI:23503 |
| EC No. | 200-687-9 |
| DTXSID | DTXSID40859074 |
| Lokaler Name | L-4-Aminoisoxazolidin-3-on |
Chemische & physikalische Eigenschaften
| XLogP | -1,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 64,4 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 7 |
| Formalladung | 0 |
| Komplexität | 92,9 |
| Arzneimittel | Pharmaceuticals -> Antibiotics |
| Schmelzpunkt | 147 °C |
| Siedepunkt | 191.38°C (rough estimate) |
| Dichte | 1.278 |
| Brechungsindex | 1.5110 (estimate) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| Löslichkeit | H2O: soluble50mg/mg proteinH2O: 50mg/mg protein |
| Aggregatzustand | White to off-white powder. |
| pKa (Säurekonstante) | 14.36±0.40(Predicted) |
| Farbe | White to Off-White |
| BRN | 80799 |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | DYDCUQKUCUHJBH-REOHCLBHSA-N |
| SMILES | N[C@H]1CONC1=O |
| CAS Datenbank | 339-72-0(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| F | 10 |
| Wassergefährdungsklasse (WGK) | 2 |
| RTECS-Nr. | NY2976000 |
| R-Sätze (R) | 5-20 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 38-36/37 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
L-Cycloserine is an irreversible inhibitor of 3-ketodihydrosphingosine synthetase.