HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Bromo-5-fluoropyridin-3-amine
2-bromo-5-fluoropyridin-3-amine · 3-Amino-2-bromo-5-fL · 2-Bromo-5-fluoro-3-pyridinamine · 3-AMINO-2-BROMO-5-FLUOROPYRIDINE · 2-broMo-5-fluoro-3-aMinopyridine · 3-Pyridinamine, 2-bromo-5-fluoro- · 2-Bromo-5-fluoro-pyridin-3-ylamine · 3-Amino-2-bromo-5-fluoropyridine,97%
Identifikatoren & physikalische Daten
| CAS No. | 884495-03-8 |
|---|---|
| Summenformel | C5H4BrFN2 |
| Durchschnittliche Molmasse | 191 g/mol |
| Monoisotopische Masse | 189,95418845 g/mol |
| SMILES | Nc1cc(F)cnc1Br |
| InChIKey | QUZAKZBKMMUARE-UHFFFAOYSA-N |
| PubChem CID | 40427367 |
| EC No. | 675-558-7 |
| DTXSID | DTXSID90654273 |
Chemische & physikalische Eigenschaften
| XLogP | 1,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 38,9 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 101 |
| Schmelzpunkt | 114-116 °C |
| Siedepunkt | 273.6±35.0 °C(Predicted) |
| Dichte | 1.813±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| Aggregatzustand | solid |
| pKa (Säurekonstante) | -0.50±0.10(Predicted) |
| Farbe | White to off-white |
| InChI | InChI=1S/C5H4BrFN2/c6-5-4(8)1-3(7)2-9-5/h1-2H,8H2 |
| InChIKey | QUZAKZBKMMUARE-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(F)C=C1N |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (89.1%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (89.1%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 2933399990 |
| R-Sätze (R) | 22-41 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 26-39 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 OralEye Dam. 1 |
Anwendungen & Verwendung
Beschreibung
3-Amino-2-bromo-5-fluoropyridine is a polyhalogenated pyridine with the chemical formula C5H4BrFN2. The compound has three functional groups: amino, bromine and fluorine, which change its reactivity. It is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.