HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-amino-2-(4-fluorophenyl)quinazolin-4(3H)-one
3-Amino-2-(4-fluorophenyl)quinazolin-4(3H)-one · 4(3H)-Quinazolinone, 3-amino-2-(4-fluorophenyl)-
Identifikatoren & physikalische Daten
| CAS No. | 388106-35-2 |
|---|---|
| Summenformel | C14H10FN3O |
| Durchschnittliche Molmasse | 255,25 g/mol |
| Monoisotopische Masse | 255,08079011 g/mol |
| SMILES | Nn1c(-c2ccc(F)cc2)nc2ccccc2c1=O |
| InChIKey | LYISEFIMIOLRPY-UHFFFAOYSA-N |
| PubChem CID | 4052011 |
| ChEMBL | CHEMBL1350533 |
| DTXSID | DTXSID301326903 |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 58,7 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 390 |
| Löslichkeit | 32.9 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 429.2±47.0 °C(Predicted) |
| Dichte | 1.38±0.1 g/cm3(Predicted) |
| pKa (Säurekonstante) | -1.71±0.20(Predicted) |