HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Mestranol
MESTRANOL · 33355 · EE3ME · d-MVE · sc4725 · RS 1044 · Devocin · Norquen
Identifikatoren & physikalische Daten
| CAS No. | 72-33-3 |
|---|---|
| Summenformel | C21H26O2 |
| Durchschnittliche Molmasse | 310,4 g/mol |
| Monoisotopische Masse | 310,19328007 g/mol |
| SMILES | C#CC1(O)CCC2C3CCc4cc(OC)ccc4C3CCC21C |
| InChIKey | IMSSROKUHAOUJS-UHFFFAOYSA-N |
| PubChem CID | 4080 |
| Lokaler Name | Mestranol |
Chemische & physikalische Eigenschaften
| XLogP | 4 |
|---|---|
| Polarare Oberfläche (TPSA) | 29,5 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 519 |
| SpringerMaterials Properties | Fusion temperature |
| Schmelzpunkt | 153-155 °C(lit.) |
| Siedepunkt | 390.58°C (rough estimate) |
| Dichte | 1.0865 (rough estimate) |
| Brechungsindex | 1.4900 (estimate) |
| Lagerbedingungen | Sealed in dry,2-8°C |
| Löslichkeit | Acetonitrile: 1 mg/mlEthanol: 1 mg/mlMethanol: 1 mg/ml |
| pKa (Säurekonstante) | 13.10±0.40(Predicted) |
| Aggregatzustand | Solid |
| Farbe | White to off-white |
| Merck | 5917 |
| BRN | 2625905 |
| Henry-Konstante | 2.2×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | 1S/C21H26O2/c1-4-21(22)12-10-19-18-7-5-14-13-15(23-3)6-8-16(14)17(18)9-11-20(19,21)2/h1,6,8,13,17-19,22H,5,7,9-12H2,2-3H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | IMSSROKUHAOUJS-MJCUULBUSA-N |
| SMILES | COc1ccc2C3CC[C@@]4(C)C(CC[C@@]4(O)C#C)C3CCc2c1 |
| CAS Datenbank | 72-33-3(CAS DataBase Reference) |
| NIST chemische Informationen | Mestranol(72-33-3) |
| EPA chemische Informationen | Mestranol (72-33-3) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29372900 |
| RTECS-Nr. | RC8960000 |
| R-Sätze (R) | 36/37/38-40-48-68 |
| Toxizität | LD50 oral in rat: > 10gm/kg |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 22-26-36/37/39-45-36/37 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 72-33-3(Hazardous Substances Data) |
| Gefahrenklasse | Carc. 2Eye Irrit. 2Skin Irrit. 2 |
Anwendungen & Verwendung
Verwenden
Mestranol is an orally active estrogenic steroid. It was the estrogen used in many of the first oral contraceptives