Identifikatoren & physikalische Daten
| CAS No. | 103859-15-0 |
|---|
| Summenformel | C11H15ClN2O2 |
|---|
| Durchschnittliche Molmasse | 242,7 g/mol |
|---|
| Monoisotopische Masse | 242,0822054 g/mol |
|---|
| SMILES | CN(C)CCOC(=O)Nc1ccc(Cl)cc1 |
|---|
| InChIKey | CYUUBMXAQCPXOG-UHFFFAOYSA-N |
|---|
| PubChem CID | 412484 |
|---|
| EC No. | 665-596-2 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,2 |
|---|
| Polarare Oberfläche (TPSA) | 41,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 16 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 216 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P270, P272, P280, P301+P316, P302+P352, P321, P330, P333+P317, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
