HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(S)-Norreticuline
(S)-Norreticuline · 2-DeMethylreticuline · (-)-(S)-N-Norreticuline · (1S)-1,2,3,4-tetrahydro-1-[(3-hydroxy-4-Methoxyphenyl)Methyl]-6-Methoxy-7-isoquinolinol · 7-Isoquinolinol, 1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-, (1S)-
Identifikatoren & physikalische Daten
| CAS No. | 4781-58-2 |
|---|---|
| Summenformel | C18H21NO4 |
| Durchschnittliche Molmasse | 315,4 g/mol |
| Monoisotopische Masse | 315,14705815 g/mol |
| SMILES | COc1ccc(C[C@@H]2NCCc3cc(OC)c(O)cc32)cc1O |
| InChIKey | FVEMXQCEJGGXJB-AWEZNQCLSA-N |
| PubChem CID | 441069 |
| ChEMBL | CHEMBL349584 |
| ChEBI | CHEBI:28611 |
| DTXSID | DTXSID50331558 |
Chemische & physikalische Eigenschaften
| XLogP | 2,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 71 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 380 |
| Siedepunkt | 519.5±50.0 °C(Predicted) |
| Dichte | 1.234±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 9.95±0.10(Predicted) |
Anwendungen & Verwendung
Verwenden
Reticuline (R188500) analog. (S)-Norreticuline is the precursor for the biosynthesis of Erythrina alkaloids. (S)-Norreticuline and (S)-reticuline stimulated the proliferation of cultured cells from murine hair.