HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-(tert-Butylamino)-1-(3-chlorophenyl)propan-1-ol
Dihydrobupropion · Bupropion metabolite A · Benzenemethanol, 3-chloro-α-[1-[(1,1-dimethylethyl)amino]ethyl]- · 3-CHLORO-ALPHA-[1-[(1,1-DIMETHYLETHYL)AMINO]ETHYL]BENZENEMETHANOL
Identifikatoren & physikalische Daten
| CAS No. | 119802-68-5 |
|---|---|
| Summenformel | C13H20ClNO |
| Durchschnittliche Molmasse | 241,76 g/mol |
| Monoisotopische Masse | 241,123342 g/mol |
| SMILES | CC(NC(C)(C)C)C(O)c1cccc(Cl)c1 |
| InChIKey | NDPTTXIBLSWNSF-UHFFFAOYSA-N |
| PubChem CID | 445 |
| ChEMBL | CHEMBL1304 |
| DTXSID | DTXSID50923119 |
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 32,3 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 214 |
| Physical Description | Solid |
| Collision Cross Section | 155.83 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| Siedepunkt | 347.192±27.00 °C(Press: 760.00 Torr)(predicted) |
| Dichte | 1.078 |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 13.667±0.20(predicted) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |