HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
L-Rhamnitol
L-Mannitol, 1-deoxy-
Identifikatoren & physikalische Daten
| CAS No. | 488-28-8 |
|---|---|
| Summenformel | C6H14O5 |
| Durchschnittliche Molmasse | 166,17 g/mol |
| Monoisotopische Masse | 166,08412354 g/mol |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChIKey | SKCKOFZKJLZSFA-BXKVDMCESA-N |
| PubChem CID | 445052 |
| ChEBI | CHEBI:45530 |
Chemische & physikalische Eigenschaften
| XLogP | -2 |
|---|---|
| Polarare Oberfläche (TPSA) | 101 |
| H-Brücken-Donoren | 5 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 107 |
| Löslichkeit | Methanol (Slightly), Water (Slightly) |
| Aggregatzustand | Solid |
| Siedepunkt | 468.0±40.0 °C(Predicted) |
| Dichte | 1.424±0.06 g/cm3(Predicted) |
| Schmelzpunkt | 122 °C |
| pKa (Säurekonstante) | 13.58±0.20(Predicted) |
| Farbe | White to Off-White |
| Stabilität | Hygroscopic |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
L-Rhamnitol is a derivative of L-mannitol, used in the preparation of L-fructose and D-sorbose. It is also used in the production of D-Psicose (P839620) from allitol using oxidation of the microbe strain Enterobacter Aerogenes IK7.