HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Tropin
3-TROPANOL · 8-Methyl-8-azabicyclo[3.2.1]octan-3-ol · ropine · TROPANOL · α-Tropine · Alphatropine · TROPINE(α TROPINE, TROPINOL) · N-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-OL
Identifikatoren & physikalische Daten
| CAS No. | 120-29-6 |
|---|---|
| Summenformel | C8H15NO |
| Durchschnittliche Molmasse | 141,21 g/mol |
| Monoisotopische Masse | 141,1153641 g/mol |
| SMILES | CN1[C@@H]2CC[C@H]1CC(O)C2 |
| InChIKey | CYHOMWAPJJPNMW-DHBOJHSNSA-N |
| PubChem CID | 449293 |
| ChEMBL | CHEMBL1356617 |
| ChEBI | CHEBI:15884 |
| DTXSID | DTXSID2049399 |
| Lokaler Name | Tropin |
Chemische & physikalische Eigenschaften
| XLogP | 0,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 23,5 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 123 |
| Arzneimittel | Pharmaceuticals -> Listed in ZINC15 |
| Dissociation Constants | 10.0610.33 |
| Schmelzpunkt | 50-60 °C(lit.) |
| Siedepunkt | 233 °C(lit.) |
| Dichte | 1.045 g/mL at 25 °C(lit.) |
| Brechungsindex | 1.4811 (estimate) |
| Flammpunkt | 232-234°C |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| Löslichkeit | H2O: 0.1 g/mL, clear100 g/L (20 ºC) |
| Aggregatzustand | Crystalline Powder |
| pKa (Säurekonstante) | 3.80(at 15℃) |
| Farbe | White to slightly yellow |
| pH | 12 (100g/l, H2O, 20℃) |
| Merck | 14,9781 |
| BRN | 80188 |
| Henry-Konstante | 1.3×103 mol/(m3Pa) at 25℃, Du et al. (2017) |
| InChI | 1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8+ |
| InChIKey | CYHOMWAPJJPNMW-JIGDXULJSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1C[C@H](O)C2 |
| LogP (Verteilungskoeffizient) | -0.100 (est) |
| CAS Datenbank | 120-29-6(CAS DataBase Reference) |
| NIST chemische Informationen | Tropine(120-29-6) |
| EPA chemische Informationen | 8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, (3-endo)- (120-29-6) |
Sicherheit & Vorschriften
| F | 3 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 1544 |
| Zollcode | 29399990 |
| RTECS-Nr. | YM3875000 |
| R-Sätze (R) | 26/28-20/22 |
| Gefahrensymbole | Xi,Xn |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 22-24/25 |
| Gefahrenklasse | 6.1(b) |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Tropine is an oxidative product of Tropane, used to synthesize alkaloid derivatives.