Nimesulid
Nimesulide-d5 · Nimesulide for peak identification · N-(4-NITRO-2-PHENOXYPHENYL)METHANESULFONAMIDE · Nide · Nidol · nimed · AULIN · R-805
Identifikatoren & physikalische Daten
| CAS No. | 51803-78-2 |
|---|---|
| Summenformel | C13H12N2O5S |
| Durchschnittliche Molmasse | 308,31 g/mol |
| Monoisotopische Masse | 308,04669266 g/mol |
| SMILES | CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1Oc1ccccc1 |
| InChIKey | HYWYRSMBCFDLJT-UHFFFAOYSA-N |
| PubChem CID | 4495 |
| ChEMBL | CHEMBL56367 |
| ChEBI | CHEBI:44445 |
| EC No. | 257-431-4 |
| DTXSID | DTXSID3037250 |
| Lokaler Name | Nimesulid |
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 110 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 450 |
| Schmelzpunkt | 140-146°C |
| Siedepunkt | 442.0±55.0 °C(Predicted) |
| Dichte | 1.451±0.06 g/cm3(Predicted) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Practically insoluble in water, freely soluble in acetone, slightly soluble in anhydrous ethanol.Soluble in water (<50 µg/ml), 1:10 DMSO:PBS (pH 7.2) (<200 µg/ml), ethanol (1 mg/ml), DMSO (15 mg/ml), DMF (15 mg/ml), chloroform, dichloromethane, acetone (freely soluble), and 1N NaOH. |
| pKa (Säurekonstante) | pKa 6.56± 0.03(H2O,t =25,I=0.02)(Approximate) |
| Aggregatzustand | Solid |
| Farbe | Light orange to Yellow to Green |
| Biologische Quelle | synthetic (organic) |
| Merck | 14,6548 |
| Stabilität | Stable. Incompatible with strong oxidizing agents. |
| Hauptanwendungen | pharmaceutical (small molecule) |
| InChI | 1S/C13H12N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h2-9,14H,1H3 |
| InChIKey | HYWYRSMBCFDLJT-UHFFFAOYSA-N |
| SMILES | CS(NC1=C(OC2=CC=CC=C2)C=C([N+]([O-])=O)C=C1)(=O)=O |
| CAS Datenbank | 51803-78-2(CAS DataBase Reference) |
| EPA chemische Informationen | Methanesulfonamide, N-(4-nitro-2-phenoxyphenyl)- (51803-78-2) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | UN 2811 6.1/PG 3 |
| Zollcode | 2935.90.9500 |
| RTECS-Nr. | PB0970000 |
| R-Sätze (R) | 22-36/37/38 |
| Toxizität | LD50 orally in rats: 324 mg/kg (Swingle, Moore) |
| Gefahrensymbole | Xn,Xi |
| Sicherheitshinweise (S) | 36-26 |
| Gefahrenklasse | 6.1Acute Tox. 3 Oral |
| Verpackungsgruppe | III |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Beschreibung
Nimesulide is a relatively COX-2 selective, non-steroidal anti-inflammatory drug (NSAID) with analgesic and antipyretic properties. It is indicated for the treatment of acute pain, symptomatic treatment of osteoarthritis and primary dysmenorrhoea in adolescents and adults. However, due to the risk of causing hepatotoxicity, it should not be taken long-term. It has also been withdrawn from the markets in many countries. It mechanism of action is through targeting on various key mediators in the inflammatory process such as COX-2 mediated prostaglandins, free radicals, proteolytic enzymes and histamine.
Verwenden
Labelled Nimesulide (N477500). Antiinflammatory agent. Preferentially inhibits COX-2 over COX-1. Suppresses chemical-induced carcinogenesis in mice and rats. Inhibits LPS-induced TNF-α production.