HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
8,9,10-Trinorbornan-2-on
BICYCLO[2.2.1]HEPTAN-2-ONE · 2-NORBORNANONE · Norcampher · (1S,4R)-bicyclo[2.2.1]heptan-2-one · Norbornanone · 2-NORCAMPHOR · NORCAMPHOR(SG) · Norcamphor,99%
Identifikatoren & physikalische Daten
| CAS No. | 497-38-1 |
|---|---|
| Summenformel | C7H10O |
| Durchschnittliche Molmasse | 110,15 g/mol |
| Monoisotopische Masse | 110,07316494 g/mol |
| SMILES | O=C1C[C@H]2CC[C@@H]1C2 |
| InChIKey | KPMKEVXVVHNIEY-NTSWFWBYSA-N |
| PubChem CID | 449588 |
| ChEBI | CHEBI:44211 |
| Lokaler Name | 8,9,10-Trinorbornan-2-on |
Chemische & physikalische Eigenschaften
| XLogP | 1 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 128 |
| Dampfdruck | 2.09 [mmHg] |
| Physical Description | White or cream crystals or waxy solid[Alfa Aesar MSDS] |
| Schmelzpunkt | 93-96 °C(lit.) |
| Siedepunkt | 168-172 °C(lit.) |
| Dichte | 0.9023 (rough estimate) |
| Brechungsindex | 1.4800 (estimate) |
| Flammpunkt | 93 °F |
| Lagerbedingungen | Flammables area |
| Aggregatzustand | Adhering Crystals |
| Farbe | Colorless to white |
| Löslichkeit | Insoluble in water. Soluble in methanol. |
| BRN | 1209657 |
| Henry-Konstante | 4.3×10-1 mol/(m3Pa) at 25℃, Roon et al. (2005) |
| InChI | InChI=1S/C7H10O/c8-7-4-5-1-2-6(7)3-5/h5-6H,1-4H2 |
| InChIKey | KPMKEVXVVHNIEY-UHFFFAOYSA-N |
| SMILES | C12CC(CC1)CC2=O |
| LogP (Verteilungskoeffizient) | 0.892 (est) |
| CAS Datenbank | 497-38-1(CAS DataBase Reference) |
| EPA chemische Informationen | Bicyclo[2.2.1]heptan-2-one (497-38-1) |
Sicherheit & Vorschriften
| Gefahrenübersicht | Intravenous LD50 (mouse) = 180 mg/kg[RTECS] May cause irritation[Alfa Aesar MSDS] See D-Camphor. |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1325 4.1/PG 2 |
| Zollcode | 29142900 |
| RTECS-Nr. | RB7680000 |
| R-Sätze (R) | 11 |
| Toxizität | LD50 ivn-mus: 180 mg/kg CSLNX* NX#04039 |
| Gefahrensymbole | F |
| Sicherheitshinweise (S) | 16-33 |
| Gefahrenklasse | 4.1Flam. Sol. 1 |
| Verpackungsgruppe | III |
| Lagerklasse | 4.1B - Flammable solid hazardous materials |
Anwendungen & Verwendung
Verwenden
Norcamphor is used as a building block in organic synthesis. It is also used as a precursor to norborneols.