HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 45050525Erstellt: 3. November 2026
4-Ethyl-2,6-diphenylpyrylium tetrafluoroborate
4-Ethyl-2,6-diphenylpyrylium tetrafluoroborate
https://huagongshe.com/de/chemical/45050525
Identifikatoren & physikalische Daten
| CAS No. | 56179-53-4 |
|---|
| Summenformel | C19H17BF4O |
|---|
| Durchschnittliche Molmasse | 348,1 g/mol |
|---|
| Monoisotopische Masse | 348,130858 g/mol |
|---|
| SMILES | CCc1cc(-c2ccccc2)[o+]c(-c2ccccc2)c1.F[B-](F)(F)F |
|---|
| InChIKey | KATQOVAASUKZCL-UHFFFAOYSA-N |
|---|
| PubChem CID | 45050525 |
|---|
| EC No. | 659-887-3 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 1 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 25 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 269 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH318 (100%): Causes serious eye damage [Danger Serious eye damage/eye irritation]P264+P265, P280, P305+P354+P338, and P317 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Eye Dam. 1 (100%) |
|---|
| Alarmwort | Achtung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H318 |
|---|
