HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 453068Erstellt: 2. November 2026
Quinoline, 4-(4-methyl-1-piperazinyl)-2-(3-pyridinyl)-
4-(4-Methylpiperazin-1-yl)-2-(pyridin-3-yl)quinoline · Quinoline, 4-(4-methyl-1-piperazinyl)-2-(3-pyridinyl)-
https://huagongshe.com/de/chemical/453068
Identifikatoren & physikalische Daten
| CAS No. | 133671-62-2 |
|---|
| Summenformel | C19H20N4 |
|---|
| Durchschnittliche Molmasse | 304,4 g/mol |
|---|
| Monoisotopische Masse | 304,16879665 g/mol |
|---|
| SMILES | CN1CCN(c2cc(-c3cccnc3)nc3ccccc23)CC1 |
|---|
| InChIKey | OCEKOVHNNIVORN-UHFFFAOYSA-N |
|---|
| PubChem CID | 453068 |
|---|
| ChEMBL | CHEMBL51136 |
|---|
| EC No. | 167-498-0 |
|---|
| DTXSID | DTXSID90158307 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|
| Polarare Oberfläche (TPSA) | 32,3 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 23 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 380 |
|---|
| Schmelzpunkt | 127-128 °C |
|---|
| Siedepunkt | 513.6±50.0 °C(Predicted) |
|---|
| Dichte | 1.177±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 7.86±0.61(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
