HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,1,1,3,3-Pentafluoro-3-methoxy-2-(trifluoromethyl)propane
OCTAFLUOROISOBUTYLMETHYLETHER · Octafluoroisobutyl ether methyl
Identifikatoren & physikalische Daten
| CAS No. | 382-26-3 |
|---|---|
| Summenformel | C5H4F8O |
| Durchschnittliche Molmasse | 232,07 g/mol |
| Monoisotopische Masse | 232,01344051 g/mol |
| SMILES | COC(F)(F)C(C(F)(F)F)C(F)(F)F |
| InChIKey | AQHKYFLVHBIQMS-UHFFFAOYSA-N |
| PubChem CID | 45459 |
| EC No. | 609-534-4 |
| DTXSID | DTXSID40880146 |
Chemische & physikalische Eigenschaften
| XLogP | 3,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 9,2 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 9 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 177 |
| PFAS | PFAS -> Other/unspecifiedPFAS -> PFAS identified in REACH Regulation EC No. 1272/2008PFAS -> OECD CategoryPFAS -> Suspected persistent, mobile, toxic (PMT) PFAS or PFAS-like compounds |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH225 (33.3%): Highly Flammable liquid and vapor [Danger Flammable liquids]P203, P210, P233, P240, P241, P242, P243, P260, P261, P262, P264, P270, P271, P272, P280, P284, P301+P316, P302+P352, P303+P361+P353, P304+P340, P316, P318, P320, P321, P330, P333+P317, P361+P364, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Status: Active Update: 19-03-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/7493 |
| Hazard Classes and Categories | Flam. Liq. 2 (33.3%) |