HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(3S,4aS,8aS)-N-(tert-Butyl)decahydroisoquinoline-3-carboxamide
Phiq · [3S-(3 · TIMTEC-BB SBB009946 · decahydroisoquinoline-3-carboxamide · Butyldecahydroisoquinoline-3-carboxamide · N-(tert-butyl)Decahydroisoquinolinecarboxamide · 4-chloro-2-fluoro-10-chlorosulfonylbenzoicacid · -N-t-butyl decahydro-3-iso-quinolinecarboxamide
Identifikatoren & physikalische Daten
| CAS No. | 136465-81-1 |
|---|---|
| Summenformel | C14H26N2O |
| Durchschnittliche Molmasse | 238,37 g/mol |
| Monoisotopische Masse | 238,20451345 g/mol |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1 |
| InChIKey | UPZBXVBPICTBDP-TUAOUCFPSA-N |
| PubChem CID | 454736 |
| DTXSID | DTXSID60929440 |
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 41,1 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 282 |
| Schmelzpunkt | 112-115 °C(lit.) |
| Siedepunkt | 380.97°C (rough estimate) |
| Dichte | 1.09 |
| Dampfdruck | 0.001-0.01Pa at 25-40℃ |
| Brechungsindex | 1.4590 (estimate) |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2–8 °C |
| Löslichkeit | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 15.65±0.20(Predicted) |
| Aggregatzustand | powder to crystal |
| Farbe | White to Almost white |
| InChI | 1S/C14H26N2O/c1-14(2,3)16-13(17)12-8-10-6-4-5-7-11(10)9-15-12/h10-12,15H,4-9H2,1-3H3,(H,16,17)/t10-,11+,12-/m0/s1 |
| InChIKey | UPZBXVBPICTBDP-TUAOUCFPSA-N |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1 |
| Oberflächenspannung | 51.9mN/m at 1g/L and 20℃ |
| CAS Datenbank | 136465-81-1(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29334900 |
| R-Sätze (R) | 22-41-52/53 |
| Gefahrensymbole | Xi,Xn |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 24/25-61-39-26-22 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 OralAquatic Chronic 3Eye Dam. 1 |
Anwendungen & Verwendung
Verwenden
Intermediate in the production of HIV protease inhibitors