HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 458964Erstellt: 26. Oktober 2026
2-Iodo-4-nitrobenzoic acid
2-Iodo-4-nitrobenzoic acid · Benzoic acid, 2-iodo-4-nitro-
https://huagongshe.com/de/chemical/458964
Identifikatoren & physikalische Daten
| CAS No. | 89459-38-1 |
|---|
| Summenformel | C7H4INO4 |
|---|
| Durchschnittliche Molmasse | 293,02 g/mol |
|---|
| Monoisotopische Masse | 292,91850561 g/mol |
|---|
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1I |
|---|
| InChIKey | SQICTGFCQITYDT-UHFFFAOYSA-N |
|---|
| PubChem CID | 458964 |
|---|
| EC No. | 861-542-9 |
|---|
| DTXSID | DTXSID30332583 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|
| Polarare Oberfläche (TPSA) | 83,1 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 13 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 227 |
|---|
| Schmelzpunkt | 142 °C |
|---|
| Siedepunkt | 402.8±35.0 °C(Predicted) |
|---|
| Dichte | 2.156±0.06 g/cm3(Predicted) |
|---|
| Lagerbedingungen | 2-8°C(protect from light) |
|---|
| Aggregatzustand | solid |
|---|
| pKa (Säurekonstante) | 1.99±0.13(Predicted) |
|---|
| InChI | InChI=1S/C7H4INO4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
|---|
| InChIKey | SQICTGFCQITYDT-UHFFFAOYSA-N |
|---|
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C=C1I |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Wassergefährdungsklasse (WGK) | WGK 3 |
|---|
| Zollcode | 2916399090 |
|---|
| R-Sätze (R) | 22 |
|---|
| Gefahrensymbole | Xn |
|---|
| Lagerklasse | 11 - Combustible Solids |
|---|
| Gefahrenklasse | Acute Tox. 4 Oral |
|---|
