HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 4666331Erstellt: 3. November 2026
[1-(Cyclopentylamino)-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate
https://huagongshe.com/de/chemical/4666331
Identifikatoren & physikalische Daten
| CAS No. | 852682-58-7 |
|---|
| Summenformel | C16H20BrNO3 |
|---|
| Durchschnittliche Molmasse | 354,24 g/mol |
|---|
| Monoisotopische Masse | 353,06266 g/mol |
|---|
| SMILES | CC(OC(=O)Cc1ccc(Br)cc1)C(=O)NC1CCCC1 |
|---|
| InChIKey | SJJUDEOMPTWBSA-UHFFFAOYSA-N |
|---|
| PubChem CID | 4666331 |
|---|
| ChEMBL | CHEMBL1725586 |
|---|
| DTXSID | DTXSID201329980 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|
| Polarare Oberfläche (TPSA) | 55,4 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 6 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 361 |
|---|
| Löslichkeit | 48.7 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [1-(Cyclopentylamino)-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate](/img/chemical/4666331.png)