Identifikatoren & physikalische Daten
| Summenformel | C15H12O7 |
|---|
| Durchschnittliche Molmasse | 304,25 g/mol |
|---|
| Monoisotopische Masse | 304,05830272 g/mol |
|---|
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2ccc(O)c(O)c2)C1O |
|---|
| InChIKey | CXQWRCVTCMQVQX-UHFFFAOYSA-N |
|---|
| PubChem CID | 471 |
|---|
| ChEMBL | CHEMBL337309 |
|---|
| ChEBI | CHEBI:38747 |
|---|
| DTXSID | DTXSID60859394 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,5 |
|---|
| Polarare Oberfläche (TPSA) | 127 |
|---|
| H-Brücken-Donoren | 5 |
|---|
| H-Brücken-Akzeptoren | 7 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 22 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 428 |
|---|
| Endocrine Disruptors | Potential endocrine disrupting compound |
|---|
| Collision Cross Section | 161.96 Ų [M]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
|---|
