HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Phalloidin
Nsc523214 · PHALLOIDIN · phalloidine · Glycerol Formal Impurity 5 · Phalloidin *CAS#: 17466-45-4* · PHALLOIDIN, AMANITA PHALLOIDES · Phalloidin trifluoroacetate salt · PHALLOIDIN FROM AMANITA PHALLOIDES
Identifikatoren & physikalische Daten
| CAS No. | 17466-45-4 |
|---|---|
| Summenformel | C35H48N8O11S |
| Durchschnittliche Molmasse | 788,9 g/mol |
| Monoisotopische Masse | 788,31632536 g/mol |
| SMILES | CC1NC(=O)C(CC(C)(O)CO)NC(=O)C2Cc3c([nH]c4ccccc34)SCC(NC(=O)C(C(C)O)NC1=O)C(=O)N1CC(O)CC1C(=O)NC(C)C(=O)N2 |
| InChIKey | KPKZJLCSROULON-UHFFFAOYSA-N |
| PubChem CID | 4752 |
| DTXSID | DTXSID3037254 |
| Lokaler Name | Phalloidin |
Chemische & physikalische Eigenschaften
| XLogP | -1,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 317 |
| H-Brücken-Donoren | 11 |
| H-Brücken-Akzeptoren | 12 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 55 |
| Formalladung | 0 |
| Komplexität | 1.510 |
| Schmelzpunkt | 280-282° |
| Dichte | 1.1612 (rough estimate) |
| Brechungsindex | 1.7400 (estimate) |
| Lagerbedingungen | +2C to +8C |
| Löslichkeit | DMF: 10 mg/mlDMSO: 10 mg/mlEthanol: 10 mg/mlWater: 0.5 mg/ml (warm)Soluble to 1 mg/ml in water |
| Aggregatzustand | White crystalline solid |
| Siedepunkt | 1370.5±65.0 °C(Predicted) |
| pKa (Säurekonstante) | 13.03±0.70(Predicted) |
| Farbe | Hexahydrate, needles or crystals from water |
| Biologische Quelle | Amanita phalloides |
| Merck | 13,7273 |
| BRN | 4347460 |
| Stabilität | Stable. Incompatible with strong oxidizing agents. |
| InChIKey | KPKZJLCSROULON-UHFFFAOYSA-N |
| SMILES | CC(O)C1NC(=O)C(C)NC(=O)C(CC(C)(O)CO)NC(=O)C2Cc3c(SCC(NC1=O)C(=O)N4CC(O)CC4C(=O)NC(C)C(=O)N2)[nH]c5ccccc35 |
Sicherheit & Vorschriften
| F | 18 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 3462 6.1/PG 2 |
| Zollcode | 2934999090 |
| RTECS-Nr. | SE9800000 |
| R-Sätze (R) | 26/27/28 |
| Toxizität | LD50 i.m. in albino mice: 3.3 mg/g (Vogt)LD50 i.p. in mice: 2 mg/kg (Wieland, Wieland) |
| Gefahrensymbole | T+ |
| Sicherheitshinweise (S) | 22-28-36/37-45 |
| Gefahrenklasse | 6.1(a)Acute Tox. 2 Oral |
| Verpackungsgruppe | I |
| Lagerklasse | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
| Gefahrstoffdaten | 17466-45-4(Hazardous Substances Data) |
Anwendungen & Verwendung
Beschreibung
Phalloidin is a natural mycotoxin first isolated from the death cap mushroom, A. phalloides. It binds F-actin and stabilizes actin fibers. Fluorescently labeled phalloidin is commonly used to stain F-actin in cells.
Verwenden
Phalloidin has been used: As a supplement in PEM buffer and dimethyl sulfoxide (DMSO).As a drug.In immunohistochemistry to stain F-actin.