HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 484396Erstellt: 4. November 2026
1,2-Phenanthrenediol, 4b,5,6,7,8,8a,9,10-octahydro-4b,8,8-trimethyl-, (4bS,8aS)-
1,2-Phenanthrenediol, 4b,5,6,7,8,8a,9,10-octahydro-4b,8,8-trimethyl-, (4bS,8aS)-
https://huagongshe.com/de/chemical/484396
Identifikatoren & physikalische Daten
| CAS No. | 69748-51-2 |
|---|
| Summenformel | C17H24O2 |
|---|
| Durchschnittliche Molmasse | 260,4 g/mol |
|---|
| Monoisotopische Masse | 260,17763 g/mol |
|---|
| SMILES | CC1(C)CCC[C@]2(C)c3ccc(O)c(O)c3CC[C@@H]12 |
|---|
| InChIKey | UCOVNMMLWVAZJH-WMLDXEAASA-N |
|---|
| PubChem CID | 484396 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 5,2 |
|---|
| Polarare Oberfläche (TPSA) | 40,5 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 351 |
|---|
Sicherheit & Vorschriften
| Regulatorische Informationen | 1,2-Phenanthrenediol, 4b,5,6,7,8,8a,9,10-octahydro-4b,8,8-trimethyl-, (4bS,8aS)-: Does not have an individual approval but may be used under an appropriate group standard |
|---|
