Identifikatoren & physikalische Daten
| CAS No. | 956264-15-6 |
|---|
| Summenformel | C11H9Cl2N3O |
|---|
| Durchschnittliche Molmasse | 270,11 g/mol |
|---|
| Monoisotopische Masse | 269,0122673 g/mol |
|---|
| SMILES | Cn1ccc(NC(=O)c2ccc(Cl)cc2Cl)n1 |
|---|
| InChIKey | DHIYFBKOBPPKQN-UHFFFAOYSA-N |
|---|
| PubChem CID | 4862736 |
|---|
| ChEMBL | CHEMBL1476905 |
|---|
| DTXSID | DTXSID201226637 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|
| Polarare Oberfläche (TPSA) | 46,9 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 17 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 290 |
|---|
| Löslichkeit | 34.3 [ug/mL] (The mean of the results at pH 7.4) |
|---|
