Identifikatoren & physikalische Daten
| CAS No. | 790704-35-7 |
|---|
| Summenformel | C11H7N3O5 |
|---|
| Durchschnittliche Molmasse | 261,19 g/mol |
|---|
| Monoisotopische Masse | 261,03857033 g/mol |
|---|
| SMILES | O=[N+]([O-])c1ccccc1Oc1ncccc1[N+](=O)[O-] |
|---|
| InChIKey | NMAWHPYVHNGXCV-UHFFFAOYSA-N |
|---|
| PubChem CID | 4875162 |
|---|
| ChEMBL | CHEMBL1308889 |
|---|
| DTXSID | DTXSID601320073 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|
| Polarare Oberfläche (TPSA) | 114 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 6 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 340 |
|---|
| Löslichkeit | 27.3 [ug/mL] (The mean of the results at pH 7.4) |
|---|
