Identifikatoren & physikalische Daten
| CAS No. | 790717-22-5 |
|---|
| Summenformel | C16H17N5O3 |
|---|
| Durchschnittliche Molmasse | 327,34 g/mol |
|---|
| Monoisotopische Masse | 327,13313942 g/mol |
|---|
| SMILES | CC(=O)c1ccc(N2CCN(c3ncccn3)CC2)c([N+](=O)[O-])c1 |
|---|
| InChIKey | MSKDRZZSNKHSET-UHFFFAOYSA-N |
|---|
| PubChem CID | 4875294 |
|---|
| ChEMBL | CHEMBL1335585 |
|---|
| DTXSID | DTXSID001320625 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|
| Polarare Oberfläche (TPSA) | 95,2 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 7 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 24 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 455 |
|---|
| Löslichkeit | 39.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von 1-[3-Nitro-4-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]ethanone](/img/chemical/4875294.png)