HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 4875375Erstellt: 2. November 2026
[1-[2-(Cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-chloro-2-hydroxybenzoate
https://huagongshe.com/de/chemical/4875375
Identifikatoren & physikalische Daten
| CAS No. | 790720-01-3 |
|---|
| Summenformel | C18H22ClNO4 |
|---|
| Durchschnittliche Molmasse | 351,8 g/mol |
|---|
| Monoisotopische Masse | 351,1237359 g/mol |
|---|
| SMILES | CC(OC(=O)c1ccc(Cl)cc1O)C(=O)NCCC1=CCCCC1 |
|---|
| InChIKey | XMJXXJMKWLHVRX-UHFFFAOYSA-N |
|---|
| PubChem CID | 4875375 |
|---|
| ChEMBL | CHEMBL1873218 |
|---|
| DTXSID | DTXSID501323967 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4,4 |
|---|
| Polarare Oberfläche (TPSA) | 75,6 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 7 |
|---|
| Schwere Atome | 24 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 480 |
|---|
| Löslichkeit | 32.9 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [1-[2-(Cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-chloro-2-hydroxybenzoate](/img/chemical/4875375.png)