Identifikatoren & physikalische Daten
| CAS No. | 1009781-48-9 |
|---|
| Summenformel | C20H26N2O |
|---|
| Durchschnittliche Molmasse | 310,4 g/mol |
|---|
| Monoisotopische Masse | 310,20451346 g/mol |
|---|
| SMILES | CCc1ccc(CN(C)C(C)C(=O)NCc2ccccc2)cc1 |
|---|
| InChIKey | HEUVAIYAUWFMBK-UHFFFAOYSA-N |
|---|
| PubChem CID | 4883439 |
|---|
| ChEMBL | CHEMBL1380439 |
|---|
| DTXSID | DTXSID501324939 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|
| Polarare Oberfläche (TPSA) | 32,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 7 |
|---|
| Schwere Atome | 23 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 344 |
|---|
| Löslichkeit | 36.5 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von N-benzyl-2-[(4-ethylphenyl)methyl-methylamino]propanamide](/img/chemical/4883439.png)