HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Ethyl 4-(triphenylphosphoranyl)butanoate
(4-Ethoxy-4-oxobutyl)triphenylphosphonium bromide · NSC 269919 · RARECHEM FH KO 0044 · (3-Ethoxycarbonyl-propyl)-triphenyl-phosphonium · (3-(ethoxycarbonyl)propyl)triphenyl-phosphonium B · (4-ethoxy-4-oxobutyl)-triphenylphosphanium,bromide · 3- (ethoxycarbonyl) propyl] triphenylphosphine bromide · [3-(Ethoxycarbonyl)propyl]triphenylphosphonium bromide
Identifikatoren & physikalische Daten
| CAS No. | 50479-11-3 |
|---|---|
| Summenformel | C24H26O2P+ |
| Durchschnittliche Molmasse | 377,4 g/mol |
| Monoisotopische Masse | 377,16704207 g/mol |
| SMILES | CCOC(=O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChIKey | QDAPTNBPGQKGLW-UHFFFAOYSA-N |
| PubChem CID | 500024 |
Chemische & physikalische Eigenschaften
| XLogP | 5,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 27 |
| Formalladung | 1 |
| Komplexität | 386 |
| Schmelzpunkt | 165-167 °C(lit.) |
| Lagerbedingungen | Refrigerator (+4°C) |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |
| Stabilität | Hygroscopic |
| InChI | 1S/C24H26O2P.BrH/c1-2-26-24(25)19-12-20-27(21-13-6-3-7-14-21,22-15-8-4-9-16-22)23-17-10-5-11-18-23/h3-11,13-18H,2,12,19-20H2,1H31H/q+1/p-1 |
| InChIKey | JPZMNVPVVYVXAD-UHFFFAOYSA-M |
| SMILES | [Br-].CCOC(=O)CCC[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29310099 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
Reactant for:Asymmetric synthesis of antihypercholesterolemic ezetimibe via Wittig reactionWittig reactions