HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
6-[4-(3-chlorophenyl)piperazin-1-yl]-9H-purine
6-[4-(3-chlorophenyl)piperazin-1-yl]-7H-purine · 6-(4-(3-chlorophenyl)piperazin-1-yl)-9H-purine · 9H-Purine, 6-[4-(3-chlorophenyl)-1-piperazinyl]-
![Molekülstruktur von 6-[4-(3-chlorophenyl)piperazin-1-yl]-9H-purine](/img/chemical/5000906.png)
Identifikatoren & physikalische Daten
| CAS No. | 537667-14-4 |
|---|---|
| Summenformel | C15H15ClN6 |
| Durchschnittliche Molmasse | 314,77 g/mol |
| Monoisotopische Masse | 314,1046722 g/mol |
| SMILES | Clc1cccc(N2CCN(c3ncnc4nc[nH]c34)CC2)c1 |
| InChIKey | QIXXACAFRCQPFS-UHFFFAOYSA-N |
| PubChem CID | 5000906 |
| ChEMBL | CHEMBL1492414 |
| DTXSID | DTXSID001324415 |
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 60,9 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 375 |
| Löslichkeit | 0.8 [ug/mL] (The mean of the results at pH 7.4) |