HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
o-Dichlor(2H4)benzol
1,2-DICHLOROBENZENE-D4, 98 ATOM % D · Cloroben-d4 · orobenzene-d4 · 1.2-Dichlorobe · DICHLOROBENZENE D4 · O-DICHLOROBENZENE-D4 · Glycerol Impurity 51 · 1,2- twochloro benzene
Identifikatoren & physikalische Daten
| CAS No. | 2199-69-1 |
|---|---|
| Summenformel | C6H4Cl2 |
| Durchschnittliche Molmasse | 151,0284 g/mol |
| Monoisotopische Masse | 149,99411247 g/mol |
| SMILES | [2H]c1c([2H])c([2H])c(Cl)c(Cl)c1[2H] |
| InChIKey | RFFLAFLAYFXFSW-RHQRLBAQSA-N |
| PubChem CID | 519913 |
| EC No. | 218-606-0 |
| DTXSID | DTXSID00944591 |
| Lokaler Name | o-Dichlor(2H4)benzol |
Chemische & physikalische Eigenschaften
| Schmelzpunkt | -17 °C (lit.) |
|---|---|
| Siedepunkt | 178-180 °C (lit.) |
| Dichte | d = 1,34 |
| Brechungsindex | n20/D 1.5509(lit.) |
| Flammpunkt | 150 °F |
| Lagerbedingungen | 0-6°C |
| Löslichkeit | Acetone (Soluble), Chloroform (Slightly)Insoluble in water |
| Aggregatzustand | Liquid |
| Farbe | Clear colorless |
| Explosionsgrenze | 2.2-12%(V) |
| BRN | 1950096 |
| Henry-Konstante | 8.2×10-3 mol/(m3Pa) at 25℃, Hiatt (2013) |
| InChI | InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H |
| InChIKey | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
| SMILES | ClC1C([H])=C([H])C([H])=C([H])C=1Cl |
| CAS Datenbank | 2199-69-1(CAS DataBase Reference) |
| EPA chemische Informationen | 1,2-Dichlorobenzene-d4 (2199-69-1) |
Sicherheit & Vorschriften
| F | 10 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1591 6.1/PG 3 |
| Zollcode | 29039110 |
| R-Sätze (R) | 22-36/37/38-50/53-63-43-23/24/25-45-39/23/24/25-67-52/53-40-11 |
| Gefahrensymbole | Xn,N,T,F |
| Sicherheitshinweise (S) | 23-60-61-36/37-24/25-53-45-26-16 |
| Gefahrenklasse | 6.1Acute Tox. 4 InhalationAcute Tox. 4 OralAquatic Acute 1Aquatic Chronic 1Eye Irrit. 2Skin Irrit. 2Skin Sens. 1BSTOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
Isotope labelled 1,2-Dichlorobenzene is a side product of the production of chlorobenzene.