HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Fluoro-3-(trifluoromethyl)benzoic acid
uoro-3-(trifL · BUTTPARK 29\01-67 · RARECHEM AL BO 0636 · 4-tetrafluoro-m-toluic acid · 4-Fluoro-3-trifluoromethylbenz · à,à,à,4-tetrafluoro-m-toluic acid · 5-Carboxy-2-fluorobenzotrifluoride · 4-fluoro-3-trifuoromethylbenzoic acid
Identifikatoren & physikalische Daten
| CAS No. | 67515-55-3 |
|---|---|
| Summenformel | C8H4F4O2 |
| Durchschnittliche Molmasse | 208,11 g/mol |
| Monoisotopische Masse | 208,01474201 g/mol |
| SMILES | O=C(O)c1ccc(F)c(C(F)(F)F)c1 |
| InChIKey | WZBPZYCJUADXRS-UHFFFAOYSA-N |
| PubChem CID | 522268 |
| EC No. | 626-515-6 |
| DTXSID | DTXSID50334903 |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 37,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 226 |
| Schmelzpunkt | 114-116 °C (lit.) |
| Siedepunkt | 256.9±40.0 °C(Predicted) |
| Dichte | 1.489±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | soluble in Methanol |
| Aggregatzustand | powder to crystal |
| pKa (Säurekonstante) | 3.71±0.10(Predicted) |
| Farbe | White to Almost white |
| BRN | 1968716 |
| InChI | InChI=1S/C8H4F4O2/c9-6-2-1-4(7(13)14)3-5(6)8(10,11)12/h1-3H,(H,13,14) |
| InChIKey | WZBPZYCJUADXRS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C(C(F)(F)F)=C1 |
| CAS Datenbank | 67515-55-3(CAS DataBase Reference) |
| NIST chemische Informationen | 4-Fluoro-3-(trifluomethyl)benzoic acid(67515-55-3) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29163990 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36-37/39 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
In the field of chemical synthesis, 4-fluoro-3-(trifluoromethyl)benzoic acid is often used as a synthetic intermediate for the preparation of organometallic complexes and active pharmaceutical ingredients (APIs).